C17H16Cl2N4O — CID 5328627
2-amino-8-butyl-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5328627) has the molecular formula C17H16Cl2N4O and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-amino-8-butyl-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-8-butyl-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5328627 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-amino-8-butyl-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(N)nc21 |
| InChI | InChI=1S/C17H16Cl2N4O/c1-2-3-7-23-15-10(9-21-17(20)22-15)8-11(16(23)24)14-12(18)5-4-6-13(14)19/h4-6,8-9H,2-3,7H2,1H3,(H2,20,21,22) |
| InChIKey | ZRNVMCXGAZFVMN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |