C19H13N3O5 — CID 53289551
4-[(E)-[3-(4-methoxyphenyl)-5-oxooxadiazol-3-ium-4-ylidene]methyl]-2-phenyl-1,3-oxazol-5-olate (PubChem CID 53289551) has the molecular formula C19H13N3O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is 4-[(E)-[3-(4-methoxyphenyl)-5-oxooxadiazol-3-ium-4-ylidene]methyl]-2-phenyl-1,3-oxazol-5-olate.
| Compound Name | 4-[(E)-[3-(4-methoxyphenyl)-5-oxooxadiazol-3-ium-4-ylidene]methyl]-2-phenyl-1,3-oxazol-5-olate |
|---|---|
| PubChem CID | 53289551 |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-[(E)-[3-(4-methoxyphenyl)-5-oxooxadiazol-3-ium-4-ylidene]methyl]-2-phenyl-1,3-oxazol-5-olate |
| SMILES | COc1ccc([N+]2=NOC(=O)/C2=C\c2nc(-c3ccccc3)oc2[O-])cc1 |
| InChI | InChI=1S/C19H13N3O5/c1-25-14-9-7-13(8-10-14)22-16(19(24)27-21-22)11-15-18(23)26-17(20-15)12-5-3-2-4-6-12/h2-11H,1H3 |
| InChIKey | GBMZKTXQHTXHEN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|