C17H15ClN3O4+ — CID 53289563
N-(3-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide (PubChem CID 53289563) has the molecular formula C17H15ClN3O4+ and a molecular weight of 360.78 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 53289563 |
| Molecular Formula | C17H15ClN3O4+ |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2C(=O)Nc2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C17H14ClN3O4/c1-10-13(18)4-3-5-14(10)19-16(22)15-17(23)25-20-21(15)11-6-8-12(24-2)9-7-11/h3-9H,1-2H3,(H-,19,20,22,23)/p+1 |
| InChIKey | CKZNAFCJYXTCHZ-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|