C10H8Cl2N3O3+ — CID 53290629
N-(2,3-dichlorophenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide (PubChem CID 53290629) has the molecular formula C10H8Cl2N3O3+ and a molecular weight of 289.10 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 53290629 |
| Molecular Formula | C10H8Cl2N3O3+ |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | N-(2,3-dichlorophenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
| SMILES | C[n+]1[nH]oc(=O)c1C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H7Cl2N3O3/c1-15-8(10(17)18-14-15)9(16)13-6-4-2-3-5(11)7(6)12/h2-4H,1H3,(H-,13,14,16,17)/p+1 |
| InChIKey | CPFZXOHVBVOSTB-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|