C18H19N5O3 — CID 5328997
1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-methylurea (PubChem CID 5328997) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-methylurea.
| Compound Name | 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 5328997 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1nc2cc(N)ncc2cc1-c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H19N5O3/c1-20-18(24)23-17-14(6-11-9-21-16(19)8-15(11)22-17)10-4-12(25-2)7-13(5-10)26-3/h4-9H,1-3H3,(H2,19,21)(H2,20,22,23,24) |
| InChIKey | QBBDXJPRXHFUCL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |