C12H11N4O3S+ — CID 53290791
6-methyl-2-[2-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-oxoethyl]sulfanylpyridine-3-carbonitrile (PubChem CID 53290791) has the molecular formula C12H11N4O3S+ and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-methyl-2-[2-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-oxoethyl]sulfanylpyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-[2-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-oxoethyl]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 53290791 |
| Molecular Formula | C12H11N4O3S+ |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 6-methyl-2-[2-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-2-oxoethyl]sulfanylpyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)c(SCC(=O)c2c(=O)o[nH][n+]2C)n1 |
| InChI | InChI=1S/C12H10N4O3S/c1-7-3-4-8(5-13)11(14-7)20-6-9(17)10-12(18)19-15-16(10)2/h3-4H,6H2,1-2H3/p+1 |
| InChIKey | UEUVBFPEZRRVTQ-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|