C22H21N5O6 — CID 53296277
4-[[2-[2-(4-carbamoylanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53296277) has the molecular formula C22H21N5O6 and a molecular weight of 451.44 g/mol. Its IUPAC name is 4-[[2-[2-(4-carbamoylanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[[2-[2-(4-carbamoylanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296277 |
| Molecular Formula | C22H21N5O6 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 4-[[2-[2-(4-carbamoylanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | NC(=O)c1ccc(NC(=O)CC2OCCN(Cc3c([O-])on[n+]3-c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H21N5O6/c23-20(29)14-6-8-15(9-7-14)24-19(28)12-18-21(30)26(10-11-32-18)13-17-22(31)33-25-27(17)16-4-2-1-3-5-16/h1-9,18H,10-13H2,(H3-,23,24,25,28,29,31) |
| InChIKey | AKAXWUGOPUUKCE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 154.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|