C22H21IN4O6 — CID 53296229
4-[[2-[2-(4-iodoanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53296229) has the molecular formula C22H21IN4O6 and a molecular weight of 564.34 g/mol. Its IUPAC name is 4-[[2-[2-(4-iodoanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[[2-[2-(4-iodoanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296229 |
| Molecular Formula | C22H21IN4O6 |
| Molecular Weight | 564.34 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | 4-[[2-[2-(4-iodoanilino)-2-oxoethyl]-3-oxomorpholin-4-yl]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2CN2CCOC(CC(=O)Nc3ccc(I)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H21IN4O6/c1-31-17-8-6-16(7-9-17)27-18(22(30)33-25-27)13-26-10-11-32-19(21(26)29)12-20(28)24-15-4-2-14(23)3-5-15/h2-9,19H,10-13H2,1H3,(H-,24,25,28,30) |
| InChIKey | SJZGOOYBVGSYGQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|