C30H28N4O6 — CID 53296331
3-(4-methoxyphenyl)-4-[[3-oxo-2-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]morpholin-4-yl]methyl]oxadiazol-3-ium-5-olate (PubChem CID 53296331) has the molecular formula C30H28N4O6 and a molecular weight of 540.58 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-[[3-oxo-2-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]morpholin-4-yl]methyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-(4-methoxyphenyl)-4-[[3-oxo-2-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]morpholin-4-yl]methyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296331 |
| Molecular Formula | C30H28N4O6 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-[[3-oxo-2-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]morpholin-4-yl]methyl]oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2CN2CCOC(CC(=O)Nc3ccc(/C=C/c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H28N4O6/c1-38-25-15-13-24(14-16-25)34-26(30(37)40-32-34)20-33-17-18-39-27(29(33)36)19-28(35)31-23-11-9-22(10-12-23)8-7-21-5-3-2-4-6-21/h2-16,27H,17-20H2,1H3,(H-,31,32,35,37)/b8-7+ |
| InChIKey | ARALSKQFEJARHX-BQYQJAHWSA-N |
| XLogP | 2.96 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|