C19H21N5O5S — CID 53295997
4-[[3-cyclopropyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53295997) has the molecular formula C19H21N5O5S and a molecular weight of 431.47 g/mol. Its IUPAC name is 4-[[3-cyclopropyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[[3-cyclopropyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53295997 |
| Molecular Formula | C19H21N5O5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-[[3-cyclopropyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(NC(=O)CC2C(=O)N(C3CC3)C(=S)N2Cc2c([O-])on[n+]2C)cc1 |
| InChI | InChI=1S/C19H21N5O5S/c1-22-15(18(27)29-21-22)10-23-14(17(26)24(19(23)30)12-5-6-12)9-16(25)20-11-3-7-13(28-2)8-4-11/h3-4,7-8,12,14H,5-6,9-10H2,1-2H3,(H-,20,21,25,27) |
| InChIKey | NCULAHVUHIAYHK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|