C23H22N6O5S — CID 53296873
4-[[5-[2-(4-acetamidoanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53296873) has the molecular formula C23H22N6O5S and a molecular weight of 494.53 g/mol. Its IUPAC name is 4-[[5-[2-(4-acetamidoanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[[5-[2-(4-acetamidoanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296873 |
| Molecular Formula | C23H22N6O5S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 4-[[5-[2-(4-acetamidoanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CC(=O)Nc1ccc(NC(=O)CC2C(=O)N(c3ccccc3)C(=S)N2Cc2c([O-])on[n+]2C)cc1 |
| InChI | InChI=1S/C23H21N6O5S/c1-14(30)24-15-8-10-16(11-9-15)25-20(31)12-18-21(32)29(17-6-4-3-5-7-17)23(35)28(18)13-19-22(33)34-26-27(19)2/h3-11,18,33H,12-13H2,1-2H3/q-1/p+1 |
| InChIKey | KHUHWBMSCHIXMR-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|