C30H26N6O5S — CID 53296941
(Z)-N-[4-[[5-[2-(4-acetylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate (PubChem CID 53296941) has the molecular formula C30H26N6O5S and a molecular weight of 582.64 g/mol. Its IUPAC name is (Z)-N-[4-[[5-[2-(4-acetylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate.
| Compound Name | (Z)-N-[4-[[5-[2-(4-acetylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 53296941 |
| Molecular Formula | C30H26N6O5S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | (Z)-N-[4-[[5-[2-(4-acetylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
| SMILES | CC(=O)c1ccc(NC(=O)CC2C(=O)N(c3ccccc3)C(=S)N2Cc2c(/N=C(\[O-])c3ccccc3)on[n+]2C)cc1 |
| InChI | InChI=1S/C30H26N6O5S/c1-19(37)20-13-15-22(16-14-20)31-26(38)17-24-29(40)36(23-11-7-4-8-12-23)30(42)35(24)18-25-28(41-33-34(25)2)32-27(39)21-9-5-3-6-10-21/h3-16,24H,17-18H2,1-2H3,(H-,31,32,33,37,38,39) |
| InChIKey | USKSQRMVQGLZLK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|