C25H24N6O6S — CID 53297120
(Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate (PubChem CID 53297120) has the molecular formula C25H24N6O6S and a molecular weight of 536.57 g/mol. Its IUPAC name is (Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate.
| Compound Name | (Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 53297120 |
| Molecular Formula | C25H24N6O6S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | (Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2C(=O)N(C)C(=S)N2Cc2c(/N=C(\[O-])c3ccccc3)on[n+]2C)cc1 |
| InChI | InChI=1S/C25H24N6O6S/c1-29-23(34)18(13-20(32)26-17-11-9-16(10-12-17)24(35)36-3)31(25(29)38)14-19-22(37-28-30(19)2)27-21(33)15-7-5-4-6-8-15/h4-12,18H,13-14H2,1-3H3,(H-,26,27,28,32,33,35) |
| InChIKey | GPUMPVYRVUSUMQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|