C25H26N6O5S — CID 53296965
(Z)-N-[4-[[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate (PubChem CID 53296965) has the molecular formula C25H26N6O5S and a molecular weight of 522.59 g/mol. Its IUPAC name is (Z)-N-[4-[[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate.
| Compound Name | (Z)-N-[4-[[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 53296965 |
| Molecular Formula | C25H26N6O5S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | (Z)-N-[4-[[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(OC)cc2)N(Cc2c(/N=C(\[O-])c3ccccc3)on[n+]2C)C1=S |
| InChI | InChI=1S/C25H26N6O5S/c1-4-30-24(34)19(14-21(32)26-17-10-12-18(35-3)13-11-17)31(25(30)37)15-20-23(36-28-29(20)2)27-22(33)16-8-6-5-7-9-16/h5-13,19H,4,14-15H2,1-3H3,(H-,26,27,28,32,33) |
| InChIKey | WFURJATWQPSGIS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|