C19H21N5O6S — CID 53296023
4-[[3-ethyl-5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53296023) has the molecular formula C19H21N5O6S and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-[[3-ethyl-5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[[3-ethyl-5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296023 |
| Molecular Formula | C19H21N5O6S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-[[3-ethyl-5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(C(=O)OC)cc2)N(Cc2c([O-])on[n+]2C)C1=S |
| InChI | InChI=1S/C19H21N5O6S/c1-4-23-16(26)13(24(19(23)31)10-14-18(28)30-21-22(14)2)9-15(25)20-12-7-5-11(6-8-12)17(27)29-3/h5-8,13H,4,9-10H2,1-3H3,(H-,20,21,25,27,28) |
| InChIKey | DRDGLZBYWROHIO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|