C22H21N5O4S — CID 53296871
3-methyl-4-[[5-[2-(4-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate (PubChem CID 53296871) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is 3-methyl-4-[[5-[2-(4-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-methyl-4-[[5-[2-(4-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296871 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 3-methyl-4-[[5-[2-(4-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(NC(=O)CC2C(=O)N(c3ccccc3)C(=S)N2Cc2c([O-])on[n+]2C)cc1 |
| InChI | InChI=1S/C22H21N5O4S/c1-14-8-10-15(11-9-14)23-19(28)12-17-20(29)27(16-6-4-3-5-7-16)22(32)26(17)13-18-21(30)31-24-25(18)2/h3-11,17H,12-13H2,1-2H3,(H-,23,24,28,30) |
| InChIKey | JHQGGVXCJMYBQD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|