C35H28N7O5S+ — CID 53296952
N-[4-[[5-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzamide (PubChem CID 53296952) has the molecular formula C35H28N7O5S+ and a molecular weight of 658.72 g/mol. Its IUPAC name is N-[4-[[5-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzamide.
| Compound Name | N-[4-[[5-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzamide |
|---|---|
| PubChem CID | 53296952 |
| Molecular Formula | C35H28N7O5S+ |
| Molecular Weight | 658.72 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | N-[4-[[5-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzamide |
| SMILES | C[n+]1noc(NC(=O)c2ccccc2)c1CN1C(=S)N(c2ccccc2)C(=O)C1CC(=O)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C35H27N7O5S/c1-40-28(33(47-39-40)38-31(44)22-10-4-2-5-11-22)21-41-27(34(45)42(35(41)48)25-12-6-3-7-13-25)20-30(43)36-24-18-16-23(17-19-24)32-37-26-14-8-9-15-29(26)46-32/h2-19,27H,20-21H2,1H3,(H-,36,37,38,39,43,44)/p+1 |
| InChIKey | YJDWFZMGWYCZRN-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|