C26H27N6O6S+ — CID 53297130
ethyl 4-[[2-[3-[(5-benzamido-3-methyloxadiazol-3-ium-4-yl)methyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 53297130) has the molecular formula C26H27N6O6S+ and a molecular weight of 551.61 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[(5-benzamido-3-methyloxadiazol-3-ium-4-yl)methyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[(5-benzamido-3-methyloxadiazol-3-ium-4-yl)methyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 53297130 |
| Molecular Formula | C26H27N6O6S+ |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | ethyl 4-[[2-[3-[(5-benzamido-3-methyloxadiazol-3-ium-4-yl)methyl]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC2C(=O)N(C)C(=S)N2Cc2c(NC(=O)c3ccccc3)on[n+]2C)cc1 |
| InChI | InChI=1S/C26H26N6O6S/c1-4-37-25(36)17-10-12-18(13-11-17)27-21(33)14-19-24(35)30(2)26(39)32(19)15-20-23(38-29-31(20)3)28-22(34)16-8-6-5-7-9-16/h5-13,19H,4,14-15H2,1-3H3,(H-,27,28,29,33,34,36)/p+1 |
| InChIKey | IOXOWOONAUFEDV-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|