C31H28N6O6S — CID 53297009
(Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-(4-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate (PubChem CID 53297009) has the molecular formula C31H28N6O6S and a molecular weight of 612.67 g/mol. Its IUPAC name is (Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-(4-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate.
| Compound Name | (Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-(4-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 53297009 |
| Molecular Formula | C31H28N6O6S |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | (Z)-N-[4-[[5-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-3-(4-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2C(=O)N(c3ccc(C)cc3)C(=S)N2Cc2c(/N=C(\[O-])c3ccccc3)on[n+]2C)cc1 |
| InChI | InChI=1S/C31H28N6O6S/c1-19-9-15-23(16-10-19)37-29(40)24(17-26(38)32-22-13-11-21(12-14-22)30(41)42-3)36(31(37)44)18-25-28(43-34-35(25)2)33-27(39)20-7-5-4-6-8-20/h4-16,24H,17-18H2,1-3H3,(H-,32,33,34,38,39,41) |
| InChIKey | DMJNQOWOMOMGIK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|