C32H30N6O4S — CID 53297049
(Z)-N-[4-[[3-ethyl-4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate (PubChem CID 53297049) has the molecular formula C32H30N6O4S and a molecular weight of 594.70 g/mol. Its IUPAC name is (Z)-N-[4-[[3-ethyl-4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate.
| Compound Name | (Z)-N-[4-[[3-ethyl-4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 53297049 |
| Molecular Formula | C32H30N6O4S |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | (Z)-N-[4-[[3-ethyl-4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-2-sulfanylideneimidazolidin-1-yl]methyl]-3-methyloxadiazol-3-ium-5-yl]benzenecarboximidate |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(/C=C/c3ccccc3)cc2)N(Cc2c(/N=C(\[O-])c3ccccc3)on[n+]2C)C1=S |
| InChI | InChI=1S/C32H30N6O4S/c1-3-37-31(41)26(20-28(39)33-25-18-16-23(17-19-25)15-14-22-10-6-4-7-11-22)38(32(37)43)21-27-30(42-35-36(27)2)34-29(40)24-12-8-5-9-13-24/h4-19,26H,3,20-21H2,1-2H3,(H-,33,34,35,39,40)/b15-14+ |
| InChIKey | FVPYNQUTCKILGQ-CCEZHUSRSA-N |
| XLogP | 3.45 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|