C29H25N5O4S — CID 53296887
3-methyl-4-[[4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate (PubChem CID 53296887) has the molecular formula C29H25N5O4S and a molecular weight of 539.62 g/mol. Its IUPAC name is 3-methyl-4-[[4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-methyl-4-[[4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296887 |
| Molecular Formula | C29H25N5O4S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 3-methyl-4-[[4-oxo-5-[2-oxo-2-[4-[(E)-2-phenylethenyl]anilino]ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]methyl]oxadiazol-3-ium-5-olate |
| SMILES | C[n+]1noc([O-])c1CN1C(=S)N(c2ccccc2)C(=O)C1CC(=O)Nc1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N5O4S/c1-32-25(28(37)38-31-32)19-33-24(27(36)34(29(33)39)23-10-6-3-7-11-23)18-26(35)30-22-16-14-21(15-17-22)13-12-20-8-4-2-5-9-20/h2-17,24H,18-19H2,1H3,(H-,30,31,35,37)/b13-12+ |
| InChIKey | RVEUANPZXYWKAK-OUKQBFOZSA-N |
| XLogP | 3.27 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|