C19H22N5O6S+ — CID 53296024
methyl 4-[[2-[1-ethyl-3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 53296024) has the molecular formula C19H22N5O6S+ and a molecular weight of 448.48 g/mol. Its IUPAC name is methyl 4-[[2-[1-ethyl-3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[1-ethyl-3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 53296024 |
| Molecular Formula | C19H22N5O6S+ |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | methyl 4-[[2-[1-ethyl-3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(C(=O)OC)cc2)N(Cc2c(=O)o[nH][n+]2C)C1=S |
| InChI | InChI=1S/C19H21N5O6S/c1-4-23-16(26)13(24(19(23)31)10-14-18(28)30-21-22(14)2)9-15(25)20-12-7-5-11(6-8-12)17(27)29-3/h5-8,13H,4,9-10H2,1-3H3,(H-,20,21,25,27,28)/p+1 |
| InChIKey | DRDGLZBYWROHIO-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|