C21H21N3O5S — CID 26524821
methyl 4-[[2-[(4R)-3-(furan-2-ylmethyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 26524821) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is methyl 4-[[2-[(4R)-3-(furan-2-ylmethyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4R)-3-(furan-2-ylmethyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 26524821 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | methyl 4-[[2-[(4R)-3-(furan-2-ylmethyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | C=CCN1C(=O)[C@@H](CC(=O)Nc2ccc(C(=O)OC)cc2)N(Cc2ccco2)C1=S |
| InChI | InChI=1S/C21H21N3O5S/c1-3-10-23-19(26)17(24(21(23)30)13-16-5-4-11-29-16)12-18(25)22-15-8-6-14(7-9-15)20(27)28-2/h3-9,11,17H,1,10,12-13H2,2H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | VOZWBRAAILOFGU-QGZVFWFLSA-N |
| XLogP | 2.58 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|