About 5-bromo-N,N-dibutylpentanamide
5-bromo-N,N-dibutylpentanamide (PubChem CID 532964) has the molecular formula C13H26BrNO
and a molecular weight of 292.26 g/mol. Its IUPAC name is 5-bromo-N,N-dibutylpentanamide.
Molecular Properties
| Compound Name | 5-bromo-N,N-dibutylpentanamide |
| PubChem CID | 532964 |
| Molecular Formula | C13H26BrNO |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 5-bromo-N,N-dibutylpentanamide |
| SMILES | CCCCN(CCCC)C(=O)CCCCBr |
| InChI | InChI=1S/C13H26BrNO/c1-3-5-11-15(12-6-4-2)13(16)9-7-8-10-14/h3-12H2,1-2H3 |
| InChIKey | YZXXOVLXZCQHGQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N,N-dibutylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,N-dibutylpentanamide?
The IUPAC name of 5-bromo-N,N-dibutylpentanamide (CID 532964) is 5-bromo-N,N-dibutylpentanamide.
What is the SMILES notation for 5-bromo-N,N-dibutylpentanamide?
The canonical SMILES for 5-bromo-N,N-dibutylpentanamide is CCCCN(CCCC)C(=O)CCCCBr.
What is the InChIKey of 5-bromo-N,N-dibutylpentanamide?
The InChIKey is YZXXOVLXZCQHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26BrNO/c1-3-5-11-15(12-6-4-2)13(16)9-7-8-10-14/h3-12H2,1-2H3.
What are the key properties of 5-bromo-N,N-dibutylpentanamide?
5-bromo-N,N-dibutylpentanamide has a molecular weight of 292.26 g/mol, XLogP of 3.98, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,N-dibutylpentanamide is sourced from PubChem (CID 532964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).