About 6-bromo-N,N-didecylhexanamide
6-bromo-N,N-didecylhexanamide (PubChem CID 533340) has the molecular formula C26H52BrNO
and a molecular weight of 474.61 g/mol. Its IUPAC name is 6-bromo-N,N-didecylhexanamide.
Molecular Properties
| Compound Name | 6-bromo-N,N-didecylhexanamide |
| PubChem CID | 533340 |
| Molecular Formula | C26H52BrNO |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 473.32 |
| IUPAC Name | 6-bromo-N,N-didecylhexanamide |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(=O)CCCCCBr |
| InChI | InChI=1S/C26H52BrNO/c1-3-5-7-9-11-13-15-20-24-28(26(29)22-18-17-19-23-27)25-21-16-14-12-10-8-6-4-2/h3-25H2,1-2H3 |
| InChIKey | ABYHXIDXYXTZBH-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N,N-didecylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,N-didecylhexanamide?
The IUPAC name of 6-bromo-N,N-didecylhexanamide (CID 533340) is 6-bromo-N,N-didecylhexanamide.
What is the SMILES notation for 6-bromo-N,N-didecylhexanamide?
The canonical SMILES for 6-bromo-N,N-didecylhexanamide is CCCCCCCCCCN(CCCCCCCCCC)C(=O)CCCCCBr.
What is the InChIKey of 6-bromo-N,N-didecylhexanamide?
The InChIKey is ABYHXIDXYXTZBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H52BrNO/c1-3-5-7-9-11-13-15-20-24-28(26(29)22-18-17-19-23-27)25-21-16-14-12-10-8-6-4-2/h3-25H2,1-2H3.
What are the key properties of 6-bromo-N,N-didecylhexanamide?
6-bromo-N,N-didecylhexanamide has a molecular weight of 474.61 g/mol, XLogP of 9.05, 23 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,N-didecylhexanamide is sourced from PubChem (CID 533340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).