About 5-bromo-N,N-dioctylpentanamide
5-bromo-N,N-dioctylpentanamide (PubChem CID 532971) has the molecular formula C21H42BrNO
and a molecular weight of 404.48 g/mol. Its IUPAC name is 5-bromo-N,N-dioctylpentanamide.
Molecular Properties
| Compound Name | 5-bromo-N,N-dioctylpentanamide |
| PubChem CID | 532971 |
| Molecular Formula | C21H42BrNO |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 5-bromo-N,N-dioctylpentanamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CCCCBr |
| InChI | InChI=1S/C21H42BrNO/c1-3-5-7-9-11-15-19-23(21(24)17-13-14-18-22)20-16-12-10-8-6-4-2/h3-20H2,1-2H3 |
| InChIKey | YIOIJYTYHHPOHU-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N,N-dioctylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,N-dioctylpentanamide?
The IUPAC name of 5-bromo-N,N-dioctylpentanamide (CID 532971) is 5-bromo-N,N-dioctylpentanamide.
What is the SMILES notation for 5-bromo-N,N-dioctylpentanamide?
The canonical SMILES for 5-bromo-N,N-dioctylpentanamide is CCCCCCCCN(CCCCCCCC)C(=O)CCCCBr.
What is the InChIKey of 5-bromo-N,N-dioctylpentanamide?
The InChIKey is YIOIJYTYHHPOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42BrNO/c1-3-5-7-9-11-15-19-23(21(24)17-13-14-18-22)20-16-12-10-8-6-4-2/h3-20H2,1-2H3.
What are the key properties of 5-bromo-N,N-dioctylpentanamide?
5-bromo-N,N-dioctylpentanamide has a molecular weight of 404.48 g/mol, XLogP of 7.10, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,N-dioctylpentanamide is sourced from PubChem (CID 532971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).