C32H30N2O4 — CID 53298544
(2S,6R,7R,9R,12R)-16-methoxy-4-(4-methoxyphenyl)-9-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14(19),15,17-tetraene-3,5-dione (PubChem CID 53298544) has the molecular formula C32H30N2O4 and a molecular weight of 506.60 g/mol. Its IUPAC name is (2S,6R,7R,9R,12R)-16-methoxy-4-(4-methoxyphenyl)-9-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14(19),15,17-tetraene-3,5-dione.
| Compound Name | (2S,6R,7R,9R,12R)-16-methoxy-4-(4-methoxyphenyl)-9-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14(19),15,17-tetraene-3,5-dione |
|---|---|
| PubChem CID | 53298544 |
| Molecular Formula | C32H30N2O4 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | (2S,6R,7R,9R,12R)-16-methoxy-4-(4-methoxyphenyl)-9-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14(19),15,17-tetraene-3,5-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@@H]4C[C@H](c5ccccc5)CC[C@H]4c4c([nH]c5ccc(OC)cc45)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C32H30N2O4/c1-37-21-11-9-20(10-12-21)34-31(35)28-24-16-19(18-6-4-3-5-7-18)8-14-23(24)27-25-17-22(38-2)13-15-26(25)33-30(27)29(28)32(34)36/h3-7,9-13,15,17,19,23-24,28-29,33H,8,14,16H2,1-2H3/t19-,23-,24-,28-,29+/m1/s1 |
| InChIKey | DEXLCGGYIACTEW-NHSWXKKESA-N |
| XLogP | 6.14 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|