C24H22N2O2 — CID 10406844
(2R,6R,7R,12R)-4-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione (PubChem CID 10406844) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2R,6R,7R,12R)-4-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione.
| Compound Name | (2R,6R,7R,12R)-4-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione |
|---|---|
| PubChem CID | 10406844 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2R,6R,7R,12R)-4-phenyl-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3CCCC[C@H]3c3c([nH]c4ccccc34)[C@@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c27-23-20-16-11-5-4-10-15(16)19-17-12-6-7-13-18(17)25-22(19)21(20)24(28)26(23)14-8-2-1-3-9-14/h1-3,6-9,12-13,15-16,20-21,25H,4-5,10-11H2/t15-,16-,20-,21-/m1/s1 |
| InChIKey | YQDIZAHKTNEAGG-IMAQQZIHSA-N |
| XLogP | 4.73 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|