C21H22N2O2 — CID 101469319
(7S,11S)-4-methyl-9-(4-methylphenyl)-3,9-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-2(6),4-diene-8,10-dione (PubChem CID 101469319) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (7S,11S)-4-methyl-9-(4-methylphenyl)-3,9-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-2(6),4-diene-8,10-dione.
| Compound Name | (7S,11S)-4-methyl-9-(4-methylphenyl)-3,9-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-2(6),4-diene-8,10-dione |
|---|---|
| PubChem CID | 101469319 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (7S,11S)-4-methyl-9-(4-methylphenyl)-3,9-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-2(6),4-diene-8,10-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3c4cc(C)[nH]c4C4CCCC4[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H22N2O2/c1-11-6-8-13(9-7-11)23-20(24)17-14-4-3-5-15(14)19-16(10-12(2)22-19)18(17)21(23)25/h6-10,14-15,17-18,22H,3-5H2,1-2H3/t14?,15?,17-,18+/m0/s1 |
| InChIKey | SDMQWBCBDBGUDP-MUDYYLEHSA-N |
| XLogP | 3.80 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|