C9H17NO6S — CID 53298717
methyl (2S,3S,4S,5R,6S)-6-(2-aminoethylsulfanyl)-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 53298717) has the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-6-(2-aminoethylsulfanyl)-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-6-(2-aminoethylsulfanyl)-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 53298717 |
| Molecular Formula | C9H17NO6S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-6-(2-aminoethylsulfanyl)-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](SCCN)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17NO6S/c1-15-8(14)7-5(12)4(11)6(13)9(16-7)17-3-2-10/h4-7,9,11-13H,2-3,10H2,1H3/t4-,5-,6+,7-,9-/m0/s1 |
| InChIKey | RFHOUCJSGFDVLE-MNDKRXPHSA-N |
| XLogP | -2.34 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |