C25H29N3O7 — CID 5330109
6,7-bis(2-methoxyethoxy)-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile (PubChem CID 5330109) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile.
| Compound Name | 6,7-bis(2-methoxyethoxy)-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5330109 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile |
| SMILES | COCCOc1cc2ncc(C#N)c(Nc3cc(OC)c(OC)c(OC)c3)c2cc1OCCOC |
| InChI | InChI=1S/C25H29N3O7/c1-29-6-8-34-20-12-18-19(13-21(20)35-9-7-30-2)27-15-16(14-26)24(18)28-17-10-22(31-3)25(33-5)23(11-17)32-4/h10-13,15H,6-9H2,1-5H3,(H,27,28) |
| InChIKey | BTBPPLGKNLXRGR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|