C31H45N7O3 — CID 5330135
1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[5-(4-methylpiperazin-1-yl)pentylamino]-1,6-naphthyridin-2-yl]urea (PubChem CID 5330135) has the molecular formula C31H45N7O3 and a molecular weight of 563.75 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[5-(4-methylpiperazin-1-yl)pentylamino]-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[5-(4-methylpiperazin-1-yl)pentylamino]-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330135 |
| Molecular Formula | C31H45N7O3 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[5-(4-methylpiperazin-1-yl)pentylamino]-1,6-naphthyridin-2-yl]urea |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(NCCCCCN4CCN(C)CC4)cc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C31H45N7O3/c1-31(2,3)36-30(39)35-29-26(22-16-24(40-5)19-25(17-22)41-6)18-23-21-33-28(20-27(23)34-29)32-10-8-7-9-11-38-14-12-37(4)13-15-38/h16-21H,7-15H2,1-6H3,(H,32,33)(H2,34,35,36,39) |
| InChIKey | LUPSYDSJDYGOGY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|