C28H40N2O5S — CID 53301586
[(2S)-1-[(4R)-2-[(2S)-heptan-2-yl]-1,1-dioxo-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]pyrrolidin-2-yl]methanol (PubChem CID 53301586) has the molecular formula C28H40N2O5S and a molecular weight of 516.70 g/mol. Its IUPAC name is [(2S)-1-[(4R)-2-[(2S)-heptan-2-yl]-1,1-dioxo-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(4R)-2-[(2S)-heptan-2-yl]-1,1-dioxo-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 53301586 |
| Molecular Formula | C28H40N2O5S |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [(2S)-1-[(4R)-2-[(2S)-heptan-2-yl]-1,1-dioxo-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]pyrrolidin-2-yl]methanol |
| SMILES | CCCCC[C@H](C)N1C[C@H](COCc2ccccc2)Oc2cc(N3CCC[C@H]3CO)ccc2S1(=O)=O |
| InChI | InChI=1S/C28H40N2O5S/c1-3-4-6-10-22(2)30-18-26(21-34-20-23-11-7-5-8-12-23)35-27-17-24(14-15-28(27)36(30,32)33)29-16-9-13-25(29)19-31/h5,7-8,11-12,14-15,17,22,25-26,31H,3-4,6,9-10,13,16,18-21H2,1-2H3/t22-,25-,26+/m0/s1 |
| InChIKey | RKYZJKLNTURKTQ-UCGXPXSYSA-N |
| XLogP | 4.59 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|