C28H40BrN3O6 — CID 53302382
N-(3-bromophenyl)-N'-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]morpholine-4-carboximidamide (PubChem CID 53302382) has the molecular formula C28H40BrN3O6 and a molecular weight of 594.55 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]morpholine-4-carboximidamide.
| Compound Name | N-(3-bromophenyl)-N'-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 53302382 |
| Molecular Formula | C28H40BrN3O6 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-(3-bromophenyl)-N'-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]morpholine-4-carboximidamide |
| SMILES | C[C@H]1[C@@H](OCC/N=C(\Nc2cccc(Br)c2)N2CCOCC2)O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]1C42OO3 |
| InChI | InChI=1S/C28H40BrN3O6/c1-18-7-8-23-19(2)24(35-25-28(23)22(18)9-10-27(3,36-25)37-38-28)34-14-11-30-26(32-12-15-33-16-13-32)31-21-6-4-5-20(29)17-21/h4-6,17-19,22-25H,7-16H2,1-3H3,(H,30,31)/t18-,19-,22?,23+,24+,25-,27+,28?/m1/s1 |
| InChIKey | RZDXONZRRXLZJO-HAHMPTEHSA-N |
| XLogP | 4.77 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|