C28H29FN4O3 — CID 53302684
6-[(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]benzo[h]quinazolin-4-one (PubChem CID 53302684) has the molecular formula C28H29FN4O3 and a molecular weight of 488.56 g/mol. Its IUPAC name is 6-[(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]benzo[h]quinazolin-4-one.
| Compound Name | 6-[(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 53302684 |
| Molecular Formula | C28H29FN4O3 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 6-[(4-fluoro-4-pyridin-2-ylpiperidin-1-yl)methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]benzo[h]quinazolin-4-one |
| SMILES | O=c1c2cc(CN3CCC(F)(c4ccccn4)CC3)c3ccccc3c2ncn1[C@H]1CCOC[C@@H]1O |
| InChI | InChI=1S/C28H29FN4O3/c29-28(25-7-3-4-11-30-25)9-12-32(13-10-28)16-19-15-22-26(21-6-2-1-5-20(19)21)31-18-33(27(22)35)23-8-14-36-17-24(23)34/h1-7,11,15,18,23-24,34H,8-10,12-14,16-17H2/t23-,24-/m0/s1 |
| InChIKey | KMIWADVMQWGBPC-ZEQRLZLVSA-N |
| XLogP | 3.73 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|