C28H28N6O3 — CID 53302796
1-[[3-[(3R,4S)-3-hydroxyoxan-4-yl]-4-oxobenzo[h]quinazolin-6-yl]methyl]-4-pyridazin-4-ylpiperidine-4-carbonitrile (PubChem CID 53302796) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is 1-[[3-[(3R,4S)-3-hydroxyoxan-4-yl]-4-oxobenzo[h]quinazolin-6-yl]methyl]-4-pyridazin-4-ylpiperidine-4-carbonitrile.
| Compound Name | 1-[[3-[(3R,4S)-3-hydroxyoxan-4-yl]-4-oxobenzo[h]quinazolin-6-yl]methyl]-4-pyridazin-4-ylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 53302796 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 1-[[3-[(3R,4S)-3-hydroxyoxan-4-yl]-4-oxobenzo[h]quinazolin-6-yl]methyl]-4-pyridazin-4-ylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccnnc2)CCN(Cc2cc3c(=O)n([C@H]4CCOC[C@@H]4O)cnc3c3ccccc23)CC1 |
| InChI | InChI=1S/C28H28N6O3/c29-17-28(20-5-9-31-32-14-20)7-10-33(11-8-28)15-19-13-23-26(22-4-2-1-3-21(19)22)30-18-34(27(23)36)24-6-12-37-16-25(24)35/h1-5,9,13-14,18,24-25,35H,6-8,10-12,15-16H2/t24-,25-/m0/s1 |
| InChIKey | XULLJYZEBRRTTG-DQEYMECFSA-N |
| XLogP | 2.72 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|