C20H13ClFNO2S — CID 53303064
2-chloro-3-(2-fluorophenyl)-5-methyl-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 53303064) has the molecular formula C20H13ClFNO2S and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-chloro-3-(2-fluorophenyl)-5-methyl-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 2-chloro-3-(2-fluorophenyl)-5-methyl-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 53303064 |
| Molecular Formula | C20H13ClFNO2S |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-chloro-3-(2-fluorophenyl)-5-methyl-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | CC1(c2ccccc2)C(=O)Nc2sc(Cl)c(-c3ccccc3F)c2C1=O |
| InChI | InChI=1S/C20H13ClFNO2S/c1-20(11-7-3-2-4-8-11)16(24)15-14(12-9-5-6-10-13(12)22)17(21)26-18(15)23-19(20)25/h2-10H,1H3,(H,23,25) |
| InChIKey | JBIZNNATFDDAFF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|