C40H24Cl2F4N2O4S2 — CID 87345010
2-chloro-3,5-bis(2-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione;2-chloro-3-(2-fluorophenyl)-5-(3-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 87345010) has the molecular formula C40H24Cl2F4N2O4S2 and a molecular weight of 807.67 g/mol. Its IUPAC name is 2-chloro-3,5-bis(2-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione;2-chloro-3-(2-fluorophenyl)-5-(3-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 2-chloro-3,5-bis(2-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione;2-chloro-3-(2-fluorophenyl)-5-(3-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 87345010 |
| Molecular Formula | C40H24Cl2F4N2O4S2 |
| Molecular Weight | 807.67 g/mol |
| Exact Mass | 806.05 |
| IUPAC Name | 2-chloro-3,5-bis(2-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione;2-chloro-3-(2-fluorophenyl)-5-(3-fluorophenyl)-5-methyl-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | CC1(c2cccc(F)c2)C(=O)Nc2sc(Cl)c(-c3ccccc3F)c2C1=O.CC1(c2ccccc2F)C(=O)Nc2sc(Cl)c(-c3ccccc3F)c2C1=O |
| InChI | InChI=1S/2C20H12ClF2NO2S/c1-20(11-7-3-5-9-13(11)23)16(25)15-14(10-6-2-4-8-12(10)22)17(21)27-18(15)24-19(20)26;1-20(10-5-4-6-11(22)9-10)16(25)15-14(12-7-2-3-8-13(12)23)17(21)27-18(15)24-19(20)26/h2*2-9H,1H3,(H,24,26) |
| InChIKey | JBBQKMVWJIGIMB-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.67 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|