C20H9ClF2N2O2S — CID 67297405
3-[2-chloro-5-fluoro-3-(3-fluorophenyl)-4,6-dioxo-7H-thieno[2,3-b]pyridin-5-yl]benzonitrile (PubChem CID 67297405) has the molecular formula C20H9ClF2N2O2S and a molecular weight of 414.82 g/mol. Its IUPAC name is 3-[2-chloro-5-fluoro-3-(3-fluorophenyl)-4,6-dioxo-7H-thieno[2,3-b]pyridin-5-yl]benzonitrile.
| Compound Name | 3-[2-chloro-5-fluoro-3-(3-fluorophenyl)-4,6-dioxo-7H-thieno[2,3-b]pyridin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 67297405 |
| Molecular Formula | C20H9ClF2N2O2S |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 3-[2-chloro-5-fluoro-3-(3-fluorophenyl)-4,6-dioxo-7H-thieno[2,3-b]pyridin-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2(F)C(=O)Nc3sc(Cl)c(-c4cccc(F)c4)c3C2=O)c1 |
| InChI | InChI=1S/C20H9ClF2N2O2S/c21-17-14(11-4-2-6-13(22)8-11)15-16(26)20(23,19(27)25-18(15)28-17)12-5-1-3-10(7-12)9-24/h1-8H,(H,25,27) |
| InChIKey | UBHNBVROFKIFGV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|