C18H9ClF2N2O2S — CID 67297608
2-chloro-5-fluoro-3-(3-fluorophenyl)-5-pyridin-3-yl-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 67297608) has the molecular formula C18H9ClF2N2O2S and a molecular weight of 390.80 g/mol. Its IUPAC name is 2-chloro-5-fluoro-3-(3-fluorophenyl)-5-pyridin-3-yl-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 2-chloro-5-fluoro-3-(3-fluorophenyl)-5-pyridin-3-yl-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 67297608 |
| Molecular Formula | C18H9ClF2N2O2S |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 2-chloro-5-fluoro-3-(3-fluorophenyl)-5-pyridin-3-yl-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | O=C1Nc2sc(Cl)c(-c3cccc(F)c3)c2C(=O)C1(F)c1cccnc1 |
| InChI | InChI=1S/C18H9ClF2N2O2S/c19-15-12(9-3-1-5-11(20)7-9)13-14(24)18(21,10-4-2-6-22-8-10)17(25)23-16(13)26-15/h1-8H,(H,23,25) |
| InChIKey | OHOOZAAXGQYZKQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|