C32H24N2O2 — CID 53303356
3-[[3-(4-naphthalen-2-ylindol-1-yl)phenyl]methylamino]benzoic acid (PubChem CID 53303356) has the molecular formula C32H24N2O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-[[3-(4-naphthalen-2-ylindol-1-yl)phenyl]methylamino]benzoic acid.
| Compound Name | 3-[[3-(4-naphthalen-2-ylindol-1-yl)phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 53303356 |
| Molecular Formula | C32H24N2O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-[[3-(4-naphthalen-2-ylindol-1-yl)phenyl]methylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NCc2cccc(-n3ccc4c(-c5ccc6ccccc6c5)cccc43)c2)c1 |
| InChI | InChI=1S/C32H24N2O2/c35-32(36)26-9-4-10-27(20-26)33-21-22-6-3-11-28(18-22)34-17-16-30-29(12-5-13-31(30)34)25-15-14-23-7-1-2-8-24(23)19-25/h1-20,33H,21H2,(H,35,36) |
| InChIKey | VUBHFDISXVBJMI-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |