C20H21ClFN3O2S — CID 53303754
N-[2-chloro-5-[(6-fluoro-1H-indol-3-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine (PubChem CID 53303754) has the molecular formula C20H21ClFN3O2S and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[2-chloro-5-[(6-fluoro-1H-indol-3-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[2-chloro-5-[(6-fluoro-1H-indol-3-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 53303754 |
| Molecular Formula | C20H21ClFN3O2S |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[2-chloro-5-[(6-fluoro-1H-indol-3-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(Nc2cc(S(=O)(=O)c3c[nH]c4cc(F)ccc34)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H21ClFN3O2S/c1-25-8-6-14(7-9-25)24-19-11-15(3-5-17(19)21)28(26,27)20-12-23-18-10-13(22)2-4-16(18)20/h2-5,10-12,14,23-24H,6-9H2,1H3 |
| InChIKey | XUFJPUOLRTWHIU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |