C21H22F3N3O2S — CID 53304167
N-[3-(1H-indol-3-ylsulfonyl)-2-(trifluoromethyl)phenyl]-1-methylpiperidin-4-amine (PubChem CID 53304167) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[3-(1H-indol-3-ylsulfonyl)-2-(trifluoromethyl)phenyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[3-(1H-indol-3-ylsulfonyl)-2-(trifluoromethyl)phenyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 53304167 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[3-(1H-indol-3-ylsulfonyl)-2-(trifluoromethyl)phenyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(Nc2cccc(S(=O)(=O)c3c[nH]c4ccccc34)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H22F3N3O2S/c1-27-11-9-14(10-12-27)26-17-7-4-8-18(20(17)21(22,23)24)30(28,29)19-13-25-16-6-3-2-5-15(16)19/h2-8,13-14,25-26H,9-12H2,1H3 |
| InChIKey | NZVPTPRQMVGCNO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |