C23H20ClN5O — CID 5330385
N-(3-chlorophenyl)-6-[5-(2-phenoxyethylamino)-3-pyridinyl]pyrazin-2-amine (PubChem CID 5330385) has the molecular formula C23H20ClN5O and a molecular weight of 417.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-[5-(2-phenoxyethylamino)-3-pyridinyl]pyrazin-2-amine.
| Compound Name | N-(3-chlorophenyl)-6-[5-(2-phenoxyethylamino)-3-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 5330385 |
| Molecular Formula | C23H20ClN5O |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-(3-chlorophenyl)-6-[5-(2-phenoxyethylamino)-3-pyridinyl]pyrazin-2-amine |
| SMILES | Clc1cccc(Nc2cncc(-c3cncc(NCCOc4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C23H20ClN5O/c24-18-5-4-6-19(12-18)28-23-16-26-15-22(29-23)17-11-20(14-25-13-17)27-9-10-30-21-7-2-1-3-8-21/h1-8,11-16,27H,9-10H2,(H,28,29) |
| InChIKey | GNKGBKAHMOQPNP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|