C19H26F3NO3 — CID 53303876
(1R,5R)-3-hydroxy-8-[2-pentoxy-4-(trifluoromethyl)phenoxy]-3-azabicyclo[3.2.1]octane (PubChem CID 53303876) has the molecular formula C19H26F3NO3 and a molecular weight of 373.42 g/mol. Its IUPAC name is (1R,5R)-3-hydroxy-8-[2-pentoxy-4-(trifluoromethyl)phenoxy]-3-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5R)-3-hydroxy-8-[2-pentoxy-4-(trifluoromethyl)phenoxy]-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 53303876 |
| Molecular Formula | C19H26F3NO3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (1R,5R)-3-hydroxy-8-[2-pentoxy-4-(trifluoromethyl)phenoxy]-3-azabicyclo[3.2.1]octane |
| SMILES | CCCCCOc1cc(C(F)(F)F)ccc1OC1[C@@H]2CC[C@@H]1CN(O)C2 |
| InChI | InChI=1S/C19H26F3NO3/c1-2-3-4-9-25-17-10-15(19(20,21)22)7-8-16(17)26-18-13-5-6-14(18)12-23(24)11-13/h7-8,10,13-14,18,24H,2-6,9,11-12H2,1H3/t13-,14-/m1/s1 |
| InChIKey | BMLZUSJVVXGDIQ-ZIAGYGMSSA-N |
| XLogP | 4.75 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|