C20H21F6N3O2 — CID 162103877
3-[2-[2-propoxy-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-6-(trifluoromethyl)pyridazine (PubChem CID 162103877) has the molecular formula C20H21F6N3O2 and a molecular weight of 449.40 g/mol. Its IUPAC name is 3-[2-[2-propoxy-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-6-(trifluoromethyl)pyridazine.
| Compound Name | 3-[2-[2-propoxy-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-6-(trifluoromethyl)pyridazine |
|---|---|
| PubChem CID | 162103877 |
| Molecular Formula | C20H21F6N3O2 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[2-[2-propoxy-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-6-(trifluoromethyl)pyridazine |
| SMILES | CCCOc1cc(C(F)(F)F)ccc1OC1CCCCN1c1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C20H21F6N3O2/c1-2-11-30-15-12-13(19(21,22)23)6-7-14(15)31-18-5-3-4-10-29(18)17-9-8-16(27-28-17)20(24,25)26/h6-9,12,18H,2-5,10-11H2,1H3 |
| InChIKey | ZFGCIUWFGXXRAT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |