C22H23N3O5 — CID 5330469
4-(4-ethoxy-3,5-dimethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 5330469) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-(4-ethoxy-3,5-dimethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(4-ethoxy-3,5-dimethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5330469 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 4-(4-ethoxy-3,5-dimethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | CCOc1c(OC)cc(Nc2c(C#N)cnc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C22H23N3O5/c1-6-30-22-19(28-4)7-14(8-20(22)29-5)25-21-13(11-23)12-24-16-10-18(27-3)17(26-2)9-15(16)21/h7-10,12H,6H2,1-5H3,(H,24,25) |
| InChIKey | AJHAZHZGPDMIEF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |