C27H24N4O5 — CID 5330503
6-methoxy-7-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile (PubChem CID 5330503) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is 6-methoxy-7-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile.
| Compound Name | 6-methoxy-7-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5330503 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 6-methoxy-7-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile |
| SMILES | COc1cc2c(Nc3cc(OC)c(OC)c(OC)c3)c(C#N)cnc2cc1/C=C/c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C27H24N4O5/c1-33-23-14-21-22(11-18(23)6-5-17-7-9-31(32)10-8-17)29-16-19(15-28)26(21)30-20-12-24(34-2)27(36-4)25(13-20)35-3/h5-14,16H,1-4H3,(H,29,30)/b6-5+ |
| InChIKey | KJHGOKMJOZVRIM-AATRIKPKSA-N |
| XLogP | 4.69 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|