C13H7N3O — CID 53306487
2-oxo-1-phenylpyridine-3,5-dicarbonitrile (PubChem CID 53306487) has the molecular formula C13H7N3O and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-oxo-1-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-oxo-1-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 53306487 |
| Molecular Formula | C13H7N3O |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-oxo-1-phenylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(=O)n(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H7N3O/c14-7-10-6-11(8-15)13(17)16(9-10)12-4-2-1-3-5-12/h1-6,9H |
| InChIKey | FDSXJRBDRZVFLE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |