C22H26ClN5O — CID 53308168
3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(naphthalen-1-ylmethyl)guanidine;hydrochloride (PubChem CID 53308168) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is 3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(naphthalen-1-ylmethyl)guanidine;hydrochloride.
| Compound Name | 3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(naphthalen-1-ylmethyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 53308168 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(naphthalen-1-ylmethyl)guanidine;hydrochloride |
| SMILES | COc1ccc(C/N=C(/N=C(N)N)N(C)Cc2cccc3ccccc23)cc1.Cl |
| InChI | InChI=1S/C22H25N5O.ClH/c1-27(15-18-8-5-7-17-6-3-4-9-20(17)18)22(26-21(23)24)25-14-16-10-12-19(28-2)13-11-16;/h3-13H,14-15H2,1-2H3,(H4,23,24,25,26);1H |
| InChIKey | ULCIDZBXCTYYFW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|